Details for Tripropylene Glycol Monomethyl Ether

Tripropylene Glycol Monomethyl Ether
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
20324-33-8 |
| EC NO: |
243-734-9 |
| Molecular Formula: |
C11H26O5 |
| Molecular Weight: |
238.3211 |
| Specification: |
|
| InChI: |
InChI=1/C9H20O4.C2H6O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-2/h7-11H,4-6H2,1-3H3;1-2H3 |
| Synonyms: |
Tripropylene glycol monomethyl ether;1-({1-[(1-methoxypropan-2-yl)oxy]propan-2-yl}oxy)propan-2-ol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol-methoxymethane (1:1); |
| Molecular Structure: |
 |
if you are sourcing Tripropylene Glycol Monomethyl Ether from United-States ,just feel free to inquire