ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
název výrobku |
2,5-Dibromo-3-methylthiophene |
Anglický název |
2,5-Dibromo-3-methylthiophene; |
Molekulární vzorec |
C5H4Br2S |
Molekulová hmotnost |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
Registrační číslo CAS |
13191-36-1 |
EINECS |
236-147-4 |
Molekulární struktura |
|
Hustota |
2.006g/cm3 |
Bod varu |
230.2°C at 760 mmHg |
Index lomu |
1.62 |
Bod vzplanutí |
93°C |
Tlak par |
0.101mmHg at 25°C |
Riziko Codes |
R36/38:Irritating to eyes and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|