ChemNet > CAS > 2050-23-9 Diethyl suberate
2050-23-9 Diethyl suberate
| název výrobku |
Diethyl suberate |
| Synonyma |
Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| Molekulární vzorec |
C12H22O4 |
| Molekulová hmotnost |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| Registrační číslo CAS |
2050-23-9 |
| EINECS |
218-084-4 |
| Molekulární struktura |
|
| Hustota |
0.985g/cm3 |
| Bod tání |
5-284℃ |
| Bod varu |
282.6°C at 760 mmHg |
| Index lomu |
1.436 |
| Bod vzplanutí |
123.3°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|
