ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| název výrobku |
Methyl methylsulfinylmethyl sulfide |
| Synonyma |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| Molekulární vzorec |
C3H8OS2 |
| Molekulová hmotnost |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| Registrační číslo CAS |
33577-16-1 |
| EINECS |
251-577-2 |
| Molekulární struktura |
|
| Hustota |
1.223g/cm3 |
| Bod tání |
222-226℃ |
| Bod varu |
257.772°C at 760 mmHg |
| Index lomu |
1.56 |
| Bod vzplanutí |
121.4°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|
