ChemNet > CAS > 5826-73-3 dimethyl 8,9,10-trinorborn-5-ene-2,3-dicarboxylate
5826-73-3 dimethyl 8,9,10-trinorborn-5-ene-2,3-dicarboxylate
název výrobku |
dimethyl 8,9,10-trinorborn-5-ene-2,3-dicarboxylate |
Synonyma |
Dimethyl bicyclo[2.2.1]-5-hep; ene-2,3-dicarboxylate; Dimethyl carbate; 5-Norbornene-2,3-dicarboxylic acid dimethyl ester; Dimethyl 5-norbornene-2,3-dicarboxylate; dimethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate; dimethyl bicyclo[2.2.1]hept-5-ene-1,3-dicarboxylate |
Molekulární vzorec |
C11H14O4 |
Molekulová hmotnost |
210.2265 |
InChI |
InChI=1/C11H14O4/c1-14-9(12)8-6-11(10(13)15-2)4-3-7(8)5-11/h3-4,7-8H,5-6H2,1-2H3 |
Registrační číslo CAS |
5826-73-3 |
Molekulární struktura |
|
Hustota |
1.247g/cm3 |
Bod varu |
271.7°C at 760 mmHg |
Index lomu |
1.526 |
Bod vzplanutí |
129.4°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|