ChemNet > CAS > 112-79-8 Elaidic acid
112-79-8 Elaidic acid
| Produkt-Name |
Elaidic acid |
| Synonyme |
trans-9-Octadecenoic acid~trans-Oleic acid; trans-9-Octadecenic acid; (9E)-octadec-9-enoic acid |
| Molekulare Formel |
C18H34O2 |
| Molecular Weight |
282.4614 |
| InChI |
InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
| CAS Registry Number |
112-79-8 |
| EINECS |
204-006-6 |
| Molecular Structure |
|
| Dichte |
0.899g/cm3 |
| Schmelzpunkt |
43-45℃ |
| Siedepunkt |
360°C at 760 mmHg |
| Brechungsindex |
1.466 |
| Flammpunkt |
270.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
