ChemNet > CAS > 189331-47-3 5-Brom-4-methylthiophen-2-carbaldehyd
189331-47-3 5-Brom-4-methylthiophen-2-carbaldehyd
| Produkt-Name |
5-Brom-4-methylthiophen-2-carbaldehyd |
| Synonyme |
2-Thiophencarbaldehyd, 5-Brom-4-methyl-; 2-Thiophencarboxaldehyd, 5-Brom-4-methyl-; 5-Brom-4-methyl-2-thiophencarbaldehyd; 5-Brom-4-methyl-2-thiophencarboxaldehyd; 5-Brom-4-methylthiophen-2-carboxaldehyd; T5SJ BE C1 EVH [WLN] |
| Englischer Name |
5-bromo-4-methylthiophene-2-carbaldehyde; 2-Thiophenecarbaldehyde, 5-bromo-4-methyl-; 2-Thiophenecarboxaldehyde, 5-bromo-4-methyl-; 5-Bromo-4-methyl-2-thiophenecarbaldehyde; 5-Bromo-4-methyl-2-thiophenecarboxaldehyde; 5-Bromo-4-methylthiophene-2-carboxaldehyde; T5SJ BE C1 EVH [WLN] |
| Molekulare Formel |
C6H5BrOS |
| Molecular Weight |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c1-4-2-5(3-8)9-6(4)7/h2-3H,1H3 |
| CAS Registry Number |
189331-47-3 |
| Molecular Structure |
|
| Dichte |
1.667g/cm3 |
| Siedepunkt |
264.996°C at 760 mmHg |
| Brechungsindex |
1.632 |
| Flammpunkt |
114.066°C |
| Dampfdruck |
0.009mmHg at 25°C |
|