24623-20-9 6-methyl-1-indanone
Produkt-Name |
6-methyl-1-indanone |
Englischer Name |
6-methyl-1-indanone; 6-methyl-2,3-dihydro-1H-inden-1-one |
Molekulare Formel |
C10H10O |
Molecular Weight |
146.1858 |
InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
CAS Registry Number |
24623-20-9 |
Molecular Structure |
|
Dichte |
1.113g/cm3 |
Schmelzpunkt |
60-62℃ |
Siedepunkt |
265.1°C at 760 mmHg |
Brechungsindex |
1.574 |
Flammpunkt |
109.9°C |
Dampfdruck |
0.00935mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|