ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| Produkt-Name |
Methyl methylsulfinylmethyl sulfide |
| Synonyme |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| Molekulare Formel |
C3H8OS2 |
| Molecular Weight |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| CAS Registry Number |
33577-16-1 |
| EINECS |
251-577-2 |
| Molecular Structure |
|
| Dichte |
1.223g/cm3 |
| Schmelzpunkt |
222-226℃ |
| Siedepunkt |
257.772°C at 760 mmHg |
| Brechungsindex |
1.56 |
| Flammpunkt |
121.4°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
