ChemNet > CAS > 34231-78-2 Acetoxybenzaldehyde; 97%
34231-78-2 Acetoxybenzaldehyde; 97%
| Produkt-Name |
Acetoxybenzaldehyde; 97% |
| Synonyme |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
| Molekulare Formel |
C9H8O3 |
| Molecular Weight |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
| CAS Registry Number |
34231-78-2 |
| EINECS |
251-890-4 |
| Molecular Structure |
|
| Dichte |
1.183g/cm3 |
| Siedepunkt |
271.6°C at 760 mmHg |
| Brechungsindex |
1.552 |
| Flammpunkt |
117.6°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
