ChemNet > CAS > 3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
| Produkt-Name |
Diethyl 1,1-cyclobutanedicarboxylate |
| Synonyme |
1,1-Cyclobutanedicarboxylic acid diethyl ester; diethyl cyclobutane-1,1-dicarboxylate; Diethyl-1,1-cyclobutane dicarboxylate |
| Molekulare Formel |
C10H16O4 |
| Molecular Weight |
200.2316 |
| InChI |
InChI=1/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
| CAS Registry Number |
3779-29-1 |
| EINECS |
223-239-4 |
| Molecular Structure |
|
| Dichte |
1.127g/cm3 |
| Siedepunkt |
224.5°C at 760 mmHg |
| Brechungsindex |
1.469 |
| Flammpunkt |
99.7°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
