ChemNet > CAS > 40784-88-1 Ethyl 4-ethoxyphenylacetate
40784-88-1 Ethyl 4-ethoxyphenylacetate
| Produkt-Name |
Ethyl 4-ethoxyphenylacetate |
| Synonyme |
4-Ethoxyphenylacetic acid ethyl ester |
| Molekulare Formel |
C12H16O3 |
| Molecular Weight |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number |
40784-88-1 |
| Molecular Structure |
|
| Dichte |
1.045g/cm3 |
| Siedepunkt |
289.2°C at 760 mmHg |
| Brechungsindex |
1.495 |
| Flammpunkt |
116.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
