ChemNet > CAS > 42287-90-1 3-(3-Bromophenyl)propionic acid
42287-90-1 3-(3-Bromophenyl)propionic acid
Produkt-Name |
3-(3-Bromophenyl)propionic acid |
Synonyme |
3-(3-bromophenyl)propanoic acid |
Molekulare Formel |
C9H9BrO2 |
Molecular Weight |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12) |
CAS Registry Number |
42287-90-1 |
Molecular Structure |
|
Dichte |
1.531g/cm3 |
Schmelzpunkt |
72-76℃ |
Siedepunkt |
336.3°C at 760 mmHg |
Brechungsindex |
1.578 |
Flammpunkt |
157.2°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R22:;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|