Produkt-Name |
2,4-Diamino-s-triazin |
Synonyme |
;D Iaminotriazin; 1,3,5-Triazin-2,4-diamin; 2,4-Diamino-1,3,5-Triazin |
Englischer Name |
2,4-Diamino-s-triazine; Diaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-Diamino-1,3,5-Triazine |
Molekulare Formel |
C3H5N5 |
Molecular Weight |
111.1053 |
InChI |
InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
CAS Registry Number |
504-08-5 |
EINECS |
207-983-7 |
Molecular Structure |
|
Dichte |
1.508g/cm3 |
Siedepunkt |
447.6°C at 760 mmHg |
Brechungsindex |
1.716 |
Flammpunkt |
254.9°C |
Dampfdruck |
3.32E-08mmHg at 25°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|