ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
| Produkt-Name |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
| Synonyme |
2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
| Molekulare Formel |
C11H13NO7 |
| Molecular Weight |
271.2234 |
| InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
| CAS Registry Number |
5081-42-5 |
| EINECS |
225-794-8 |
| Molecular Structure |
|
| Dichte |
1.284g/cm3 |
| Siedepunkt |
420°C at 760 mmHg |
| Brechungsindex |
1.523 |
| Flammpunkt |
188.9°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
