ChemNet > CAS > 51627-47-5 2-morpholino-3-pyridinamine
51627-47-5 2-morpholino-3-pyridinamine
| Produkt-Name |
2-morpholino-3-pyridinamine |
| Synonyme |
2-morpholin-4-ylpyridin-3-amine; 3-amino-2-morpholin-4-ylpyridinium |
| Molekulare Formel |
C9H14N3O |
| Molecular Weight |
180.2264 |
| InChI |
InChI=1/C9H13N3O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7,10H2/p+1 |
| CAS Registry Number |
51627-47-5 |
| Molecular Structure |
|
| Siedepunkt |
381.9°C at 760 mmHg |
| Flammpunkt |
184.8°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
