ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
| Produkt-Name |
4-Iodophenylacetonitrile |
| Synonyme |
4-Iodobenzyl cyanide |
| Molekulare Formel |
C8H6IN |
| Molecular Weight |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| CAS Registry Number |
51628-12-7 |
| Molecular Structure |
|
| Dichte |
1.764g/cm3 |
| Siedepunkt |
285.8°C at 760 mmHg |
| Brechungsindex |
1.624 |
| Flammpunkt |
126.6°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
