541-50-4 Acetoacetic Acid
Produkt-Name |
Acetoacetic Acid |
Englischer Name |
Acetoacetic Acid; 3-Oxobutanoic acid |
Molekulare Formel |
C4H6O3 |
Molecular Weight |
102.0886 |
InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
CAS Registry Number |
541-50-4 |
Molecular Structure |
|
Dichte |
1.182g/cm3 |
Siedepunkt |
237.7°C at 760 mmHg |
Brechungsindex |
1.427 |
Flammpunkt |
111.8°C |
Dampfdruck |
0.015mmHg at 25°C |
Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|