ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
| Produkt-Name |
2-Amino-5-methoxybenzoic acid |
| Synonyme |
5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
| Molekulare Formel |
C8H8N2O |
| Molecular Weight |
148.1619 |
| InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
| CAS Registry Number |
6705-03-9 |
| Molecular Structure |
|
| Dichte |
1.17g/cm3 |
| Schmelzpunkt |
148-152℃ |
| Siedepunkt |
302.2°C at 760 mmHg |
| Brechungsindex |
1.569 |
| Flammpunkt |
136.6°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
