ChemNet > CAS > 75-39-8 Acetaldehyde ammonia trimer
75-39-8 Acetaldehyde ammonia trimer
| Produkt-Name |
Acetaldehyde ammonia trimer |
| Synonyme |
Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| Molekulare Formel |
C2H7NO |
| Molecular Weight |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| CAS Registry Number |
75-39-8 |
| EINECS |
200-868-2 |
| Molecular Structure |
|
| Dichte |
0.967g/cm3 |
| Schmelzpunkt |
95-97℃ |
| Siedepunkt |
113.8°C at 760 mmHg |
| Brechungsindex |
1.431 |
| Flammpunkt |
22.7°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
