ChemNet > CAS > 78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
| Produkt-Name |
3-(4-chlorophenyl)-1H-pyrazol-5-amine |
| Synonyme |
5-(4-chlorophenyl)-1H-pyrazol-3-amine |
| Molekulare Formel |
C9H8ClN3 |
| Molecular Weight |
193.6329 |
| InChI |
InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| CAS Registry Number |
78583-81-0 |
| Molecular Structure |
|
| Dichte |
1.378g/cm3 |
| Schmelzpunkt |
172℃ |
| Siedepunkt |
463.8°C at 760 mmHg |
| Brechungsindex |
1.67 |
| Flammpunkt |
234.3°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
