ChemNet > CAS > 81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
| Produkt-Name |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate |
| Molekulare Formel |
C8H11N3O2 |
| Molecular Weight |
181.1918 |
| InChI |
InChI=1/C8H11N3O2/c1-3-13-7(12)6-4-10-8(9)11-5(6)2/h4H,3H2,1-2H3,(H2,9,10,11) |
| CAS Registry Number |
81633-29-6 |
| Molecular Structure |
|
| Dichte |
1.217g/cm3 |
| Schmelzpunkt |
220℃ |
| Siedepunkt |
350.5°C at 760 mmHg |
| Brechungsindex |
1.556 |
| Flammpunkt |
165.8°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
