ChemNet > CAS > 823-76-7 Cyclohexyl methyl ketone
823-76-7 Cyclohexyl methyl ketone
| Produkt-Name |
Cyclohexyl methyl ketone |
| Synonyme |
Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
| Molekulare Formel |
C8H14O |
| Molecular Weight |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| CAS Registry Number |
823-76-7 |
| EINECS |
212-517-0 |
| Molecular Structure |
|
| Dichte |
0.916g/cm3 |
| Siedepunkt |
181.5°C at 760 mmHg |
| Brechungsindex |
1.448 |
| Flammpunkt |
61.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
