ChemNet > CAS > 99-14-9 Tricarballylic acid
99-14-9 Tricarballylic acid
| Produkt-Name |
Tricarballylic acid |
| Synonyme |
1,2,3-Propanetricarboxylic acid; 3-Carboxyglutaric acid; 1,2,3-Propanetricarboxylic acid; propane-1,2,3-tricarboxylic acid |
| Molekulare Formel |
C6H8O6 |
| Molecular Weight |
176.1241 |
| InChI |
InChI=1/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| CAS Registry Number |
99-14-9 |
| EINECS |
202-733-3 |
| Molecular Structure |
|
| Dichte |
1.574g/cm3 |
| Schmelzpunkt |
154-159℃ |
| Siedepunkt |
266.4°C at 760 mmHg |
| Brechungsindex |
1.529 |
| Flammpunkt |
129.2°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
