ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| product Name |
2-bromo-4-fluoroacetophenone |
| Synonyms |
2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| Molecular Formula |
C8H6BrFO |
| Molecular Weight |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| CAS Registry Number |
1006-39-9 |
| EINECS |
222-263-2 |
| Molecular Structure |
|
| Density |
1.535g/cm3 |
| Boiling point |
258.4°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
110.1°C |
| Vapour Pressur |
0.0138mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
