CAS No: 10105-42-7, Chemical Name: 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone
the physical and chemical property of 10105-42-7, 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone is provided by ChemNet.com
ChemNet > CAS > 10105-42-7 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone
10105-42-7 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone
| product Name |
1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone |
| Synonyms |
cyanuric trihydrazide; (2Z)-2,4,6-trihydrazinylidene-1,3,5-triazinane |
| Molecular Formula |
C3H9N9 |
| Molecular Weight |
171.16 |
| InChI |
InChI=1/C3H9N9/c4-10-1-7-2(11-5)9-3(8-1)12-6/h4-6H2,(H3,7,8,9,10,11,12) |
| CAS Registry Number |
10105-42-7 |
| EINECS |
233-288-3 |
| Molecular Structure |
|
| Density |
2.41g/cm3 |
| Boiling point |
382.7°C at 760 mmHg |
| Refractive index |
2.107 |
| Flash point |
185.2°C |
| Vapour Pressur |
4.64E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
