ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| product Name |
4-Chloro-3-fluorobenzonitrile |
| CAS No |
110888-15-8 |
| Synonyms |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| Molecular Formula |
C7H3ClFN |
| Molecular Weight |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
79-81°C |
| Boiling point |
214°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
83.2°C |
| Vapour Pressur |
0.159mmHg at 25°C |
| Hazard Symbols |
T,Xi:;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
Featured China Suppliers
| Telephone |
+86-21-62113509 62113270 |
| Email |
Sales@sjpharm.com |
| Address |
7966 Tingfeng Road, Jinshan District, Shanghai |
| Telephone |
+86-418-2572598;18524186165;18641820208 |
| Email |
jht@china-jht.com |
| Address |
127 Chuangyelu, Haizhou district, Fuxin, Liaoning, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Telephone |
+86-21-54450828,+86-13501997194 |
| Email |
coco.yang@fwdchem.com |
| Address |
Room 802,Lotus Tower ,159 Tianzhou Road, Xuhui District,Shanghai 200233 ,P.R.China |