ChemNet > CAS > 124276-67-1 1-(4-bromophenyl)cyclopropanecarbonitrile
124276-67-1 1-(4-bromophenyl)cyclopropanecarbonitrile
| product Name |
1-(4-bromophenyl)cyclopropanecarbonitrile |
| Synonyms |
4-(4-bromophenyl)-2-methylpyrimidine; 1-(4-Bromophenyl)-cyclopropane carbonitrile; 1-(4-broMophenyl)cyclopropane-1-carbonitrile |
| Molecular Formula |
C11H9BrN2 |
| Molecular Weight |
249.1066 |
| InChI |
InChI=1/C11H9BrN2/c1-8-13-7-6-11(14-8)9-2-4-10(12)5-3-9/h2-7H,1H3 |
| CAS Registry Number |
124276-67-1 |
| Molecular Structure |
|
| Density |
1.434g/cm3 |
| Melting point |
84℃ |
| Boiling point |
341.4°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
160.3°C |
| Vapour Pressur |
0.000159mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
