13194-68-8 4-iodo-2-methylaniline
product Name |
4-iodo-2-methylaniline |
CAS No |
13194-68-8 |
Synonyms |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
Molecular Formula |
C7H8IN |
Molecular Weight |
233.0496 |
InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
EINECS |
236-154-2 |
Molecular Structure |
|
Density |
1.791g/cm3 |
Melting point |
86-89℃ |
Boiling point |
278.4°C at 760 mmHg |
Refractive index |
1.663 |
Flash point |
122.1°C |
Vapour Pressur |
0.00428mmHg at 25°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|