ChemNet > CAS > 13368-86-0 1,2,5-Thiadiazole-3-carboxylic acid
13368-86-0 1,2,5-Thiadiazole-3-carboxylic acid
| product Name |
1,2,5-Thiadiazole-3-carboxylic acid |
| CAS No |
13368-86-0 |
| Molecular Formula |
C3H2N2O2S |
| Molecular Weight |
130.1252 |
| InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7) |
| Molecular Structure |
|
| Density |
1.67g/cm3 |
| Melting point |
89℃ |
| Boiling point |
292.8°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
130.9°C |
| Vapour Pressur |
0.000817mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|