ChemNet > CAS > 135-67-1 Phenoxazine
135-67-1 Phenoxazine
product Name |
Phenoxazine |
Synonyms |
10H-phenoxazine |
Molecular Formula |
C12H9NO |
Molecular Weight |
183.206 |
InChI |
InChI=1/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
CAS Registry Number |
135-67-1 |
EINECS |
205-210-8 |
Molecular Structure |
|
Density |
1.196g/cm3 |
Melting point |
154-159℃ |
Boiling point |
318°C at 760 mmHg |
Refractive index |
1.624 |
Flash point |
122.6°C |
Vapour Pressur |
0.000372mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|