ChemNet > CAS > 1719-06-8 Anthracene-d10
1719-06-8 Anthracene-d10
product Name |
Anthracene-d10 |
Synonyms |
(2H10)Anthracene; Perdeuterioanthracene; (~2~H_10_)anthracene |
Molecular Formula |
C14D10 |
Molecular Weight |
188.2908 |
InChI |
InChI=1/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
CAS Registry Number |
1719-06-8 |
EINECS |
217-004-5 |
Molecular Structure |
|
Density |
1.194g/cm3 |
Melting point |
218-220℃ |
Boiling point |
337.4°C at 760 mmHg |
Refractive index |
1.714 |
Flash point |
146.6°C |
Vapour Pressur |
0.000206mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|