ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
| product Name |
2,3-Dimethylbenzeneboronic acid |
| Synonyms |
2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
| Molecular Formula |
C8H11BO2 |
| Molecular Weight |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
| CAS Registry Number |
183158-34-1 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Melting point |
174-180℃ |
| Boiling point |
312.6°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
142.8°C |
| Vapour Pressur |
0.000224mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
