ChemNet > CAS > 1919-48-8 2,4,6-Triphenoxy-s-triazine
1919-48-8 2,4,6-Triphenoxy-s-triazine
product Name |
2,4,6-Triphenoxy-s-triazine |
Synonyms |
1,3,5-triazine, 2,4,6-triphenyl-; Triphenyl-s-triazine; 2,4,6-triphenoxy-1,3,5-triazine |
Molecular Formula |
C21H15N3O3 |
Molecular Weight |
357.3621 |
InChI |
InChI=1/C21H15N3O3/c1-4-10-16(11-5-1)25-19-22-20(26-17-12-6-2-7-13-17)24-21(23-19)27-18-14-8-3-9-15-18/h1-15H |
CAS Registry Number |
1919-48-8 |
EINECS |
217-644-5 |
Molecular Structure |
|
Density |
1.272g/cm3 |
Melting point |
232-237℃ |
Boiling point |
537.8°C at 760 mmHg |
Refractive index |
1.629 |
Flash point |
189.2°C |
Vapour Pressur |
4.3E-11mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|