ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
| product Name |
2-Bromo-4-fluoro-1-iodobenzene |
| Synonyms |
2-Bromo-4-fluoroiodobenzene |
| Molecular Formula |
C6H3BrFI |
| Molecular Weight |
300.8949 |
| InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| CAS Registry Number |
202865-73-4 |
| Molecular Structure |
|
| Density |
2.281g/cm3 |
| Boiling point |
243.2°C at 760 mmHg |
| Refractive index |
1.628 |
| Flash point |
100.9°C |
| Vapour Pressur |
0.0507mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
