ChemNet > CAS > 233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
| product Name |
2,6-dihydroxy-3-nitrobenzonitrile |
| Molecular Formula |
C7H4N2O4 |
| Molecular Weight |
180.1177 |
| InChI |
InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| CAS Registry Number |
233585-04-1 |
| Molecular Structure |
|
| Density |
1.69g/cm3 |
| Melting point |
238℃ |
| Boiling point |
358.2°C at 760 mmHg |
| Refractive index |
1.683 |
| Flash point |
170.5°C |
| Vapour Pressur |
1.25E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
