ChemNet > CAS > 2345-61-1 trans-3-Chloroacrylic acid
2345-61-1 trans-3-Chloroacrylic acid
| product Name |
trans-3-Chloroacrylic acid |
| Synonyms |
Acrylic acid, 3-chloro-, (E)-; (E)-3-Chloro-2-propenoic acid; (E)-3-Chloroacrylic acid; 4-02-00-01481 (Beilstein Handbook Reference); Acrylic acid, 3-chloro-, trans-; BRN 1720279; CCRIS 3546; NSC 520953; trans-beta-Chloroacrylic acid; 2-Propenoic acid, 3-chloro-, (E)- (9CI); trans-3-Chloropropenoic acid; (2E)-3-chloroprop-2-enoate |
| Molecular Formula |
C3H2ClO2 |
| Molecular Weight |
105.5003 |
| InChI |
InChI=1/C3H3ClO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/p-1/b2-1+ |
| CAS Registry Number |
2345-61-1 |
| EINECS |
219-070-0 |
| Molecular Structure |
|
| Melting point |
82-85℃ |
| Boiling point |
192.3°C at 760 mmHg |
| Flash point |
70.1°C |
| Vapour Pressur |
0.216mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
