ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
| product Name |
Trimethyl 1,3,5-benzenetricarboxylate |
| Synonyms |
Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
| Molecular Formula |
C12H18O6 |
| Molecular Weight |
258.2677 |
| InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
| CAS Registry Number |
2672-58-4 |
| EINECS |
220-215-5 |
| Molecular Structure |
|
| Density |
1.177g/cm3 |
| Melting point |
144-147℃ |
| Boiling point |
332.8°C at 760 mmHg |
| Refractive index |
1.464 |
| Flash point |
144.1°C |
| Vapour Pressur |
0.000142mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
