ChemNet > CAS > 26990-69-2 1,3-dimethyl-5-morpholino-1H-pyrazole-4-carbaldehyde
26990-69-2 1,3-dimethyl-5-morpholino-1H-pyrazole-4-carbaldehyde
product Name |
1,3-dimethyl-5-morpholino-1H-pyrazole-4-carbaldehyde |
Synonyms |
1,3-dimethyl-5-morpholin-4-yl-1H-pyrazole-4-carbaldehyde |
Molecular Formula |
C10H15N3O2 |
Molecular Weight |
209.245 |
InChI |
InChI=1/C10H15N3O2/c1-8-9(7-14)10(12(2)11-8)13-3-5-15-6-4-13/h7H,3-6H2,1-2H3 |
CAS Registry Number |
26990-69-2 |
Molecular Structure |
|
Density |
1.26g/cm3 |
Melting point |
73℃ |
Boiling point |
403.1°C at 760 mmHg |
Refractive index |
1.599 |
Flash point |
197.6°C |
Vapour Pressur |
1.04E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|