ChemNet > CAS > 28466-21-9 4-Amino-1,3,5-trimethylpyrazole
28466-21-9 4-Amino-1,3,5-trimethylpyrazole
product Name |
4-Amino-1,3,5-trimethylpyrazole |
Synonyms |
1,3,5-Trimethyl-1H-pyrazol-4-amine |
Molecular Formula |
C6H11N3 |
Molecular Weight |
125.1716 |
InChI |
InChI=1/C6H11N3/c1-4-6(7)5(2)9(3)8-4/h7H2,1-3H3 |
CAS Registry Number |
28466-21-9 |
Molecular Structure |
|
Density |
1.138g/cm3 |
Melting point |
101℃ |
Boiling point |
236.271°C at 760 mmHg |
Refractive index |
1.568 |
Flash point |
96.694°C |
Vapour Pressur |
0.048mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|