3160-35-8 4-Hydroxybenzal Acetone
| product Name |
4-Hydroxybenzal Acetone |
| CAS No |
3160-35-8 |
| Synonyms |
4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
| Molecular Formula |
C10H10O2 |
| Molecular Weight |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
| EINECS |
221-607-9 |
| Molecular Structure |
|
| Density |
1.138g/cm3 |
| Boiling point |
318.1°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
134.8°C |
| Vapour Pressur |
0.000198mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|