ChemNet > CAS > 3261-87-8 Thiodiglycolic anhydride
3261-87-8 Thiodiglycolic anhydride
| product Name |
Thiodiglycolic anhydride |
| Synonyms |
1,4-Oxathiane-2,6-dione; 2,2-Thiodiacetic acid anhydride; 1,4-oxathiane-2,6-dione |
| Molecular Formula |
C4H4O3S |
| Molecular Weight |
132.1378 |
| InChI |
InChI=1/C4H4O3S/c5-3-1-8-2-4(6)7-3/h1-2H2 |
| CAS Registry Number |
3261-87-8 |
| Molecular Structure |
|
| Density |
1.468g/cm3 |
| Melting point |
93-94℃ |
| Boiling point |
341.8°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
190.5°C |
| Vapour Pressur |
7.86E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
