ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
| product Name |
2,2-dimethyl-2H-chromene-6-carbonitrile |
| Synonyms |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
| Molecular Formula |
C12H11NO |
| Molecular Weight |
185.2218 |
| InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
| CAS Registry Number |
33143-29-2 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Melting point |
48℃ |
| Boiling point |
301°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
126.8°C |
| Vapour Pressur |
0.00108mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
