ChemNet > CAS > 342405-27-0 (4-methyl-2-phenyl-5-pyrimidinyl)methanol
342405-27-0 (4-methyl-2-phenyl-5-pyrimidinyl)methanol
product Name |
(4-methyl-2-phenyl-5-pyrimidinyl)methanol |
Synonyms |
(4-methyl-2-phenylpyrimidin-5-yl)methanol |
Molecular Formula |
C12H12N2O |
Molecular Weight |
200.2365 |
InChI |
InChI=1/C12H12N2O/c1-9-11(8-15)7-13-12(14-9)10-5-3-2-4-6-10/h2-7,15H,8H2,1H3 |
CAS Registry Number |
342405-27-0 |
Molecular Structure |
|
Density |
1.169g/cm3 |
Melting point |
76℃ |
Boiling point |
283.2°C at 760 mmHg |
Refractive index |
1.596 |
Flash point |
125.1°C |
Vapour Pressur |
0.00151mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|