ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
| product Name |
Methyl 3-methoxy-4-methylbenzoate |
| Synonyms |
3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
| CAS Registry Number |
3556-83-0 |
| Molecular Structure |
|
| Density |
1.075g/cm3 |
| Melting point |
50-120℃ |
| Boiling point |
269.5°C at 760 mmHg |
| Refractive index |
1.502 |
| Flash point |
107.5°C |
| Vapour Pressur |
0.00723mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
