ChemNet > CAS > 3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
product Name |
Diethyl 1,1-cyclobutanedicarboxylate |
Synonyms |
1,1-Cyclobutanedicarboxylic acid diethyl ester; diethyl cyclobutane-1,1-dicarboxylate; Diethyl-1,1-cyclobutane dicarboxylate |
Molecular Formula |
C10H16O4 |
Molecular Weight |
200.2316 |
InChI |
InChI=1/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
CAS Registry Number |
3779-29-1 |
EINECS |
223-239-4 |
Molecular Structure |
|
Density |
1.127g/cm3 |
Boiling point |
224.5°C at 760 mmHg |
Refractive index |
1.469 |
Flash point |
99.7°C |
Vapour Pressur |
0.0907mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|