ChemNet > CAS > 394-35-4 methyl 2-fluorobenzoate
394-35-4 methyl 2-fluorobenzoate
product Name |
methyl 2-fluorobenzoate |
Synonyms |
2-Fluorobenzoic acid methyl ester |
Molecular Formula |
C8H7FO2 |
Molecular Weight |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS Registry Number |
394-35-4 |
EINECS |
206-894-0 |
Molecular Structure |
|
Density |
1.21 |
Boiling point |
99℃ (18 torr) |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|