ChemNet > CAS > 4165-96-2 3-Phenylglutaric acid
4165-96-2 3-Phenylglutaric acid
product Name |
3-Phenylglutaric acid |
Synonyms |
3-phenylpentanedioic acid; 3-phenylpentanedioate |
Molecular Formula |
C11H10O4 |
Molecular Weight |
206.1958 |
InChI |
InChI=1/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)/p-2 |
CAS Registry Number |
4165-96-2 |
EINECS |
224-016-4 |
Molecular Structure |
|
Melting point |
140-143℃ |
Boiling point |
359.4°C at 760 mmHg |
Flash point |
185.3°C |
Vapour Pressur |
8.61E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|