ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| product Name |
2-Bromo-4,6-dimethylaniline |
| Synonyms |
Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| Molecular Formula |
C8H10BrN |
| Molecular Weight |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| CAS Registry Number |
41825-73-4 |
| EINECS |
246-337-9 |
| Molecular Structure |
|
| Density |
1.424g/cm3 |
| Melting point |
49-79℃ |
| Boiling point |
260.9°C at 760 mmHg |
| Refractive index |
1.596 |
| Flash point |
111.6°C |
| Vapour Pressur |
0.0119mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
