ChemNet > CAS > 43071-52-9 2-Acetyl-7-methoxybenzofuran,97%
43071-52-9 2-Acetyl-7-methoxybenzofuran,97%
| product Name |
2-Acetyl-7-methoxybenzofuran,97% |
| Synonyms |
2-Acetyl-7-methoxybenzofuran; 1-(7-methoxy-1-benzofuran-2-yl)ethanone |
| Molecular Formula |
C11H10O3 |
| Molecular Weight |
190.1953 |
| InChI |
InChI=1/C11H10O3/c1-7(12)10-6-8-4-3-5-9(13-2)11(8)14-10/h3-6H,1-2H3 |
| CAS Registry Number |
43071-52-9 |
| Molecular Structure |
|
| Density |
1.174g/cm3 |
| Melting point |
91℃ |
| Boiling point |
300.3°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
135.4°C |
| Vapour Pressur |
0.00113mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
